CAS 1537905-51-3 is the registry number for 2,2,2-Trifluoro-N-phenylethanecarbonimidoyl chloride, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.
2,2,2-trifluoro-N-phenylethanimidoyl chloride (CAS 1537905-51-3) is a chemical compound with the molecular formula C8H5ClF3N and a molecular weight of 207.58 g/mol. IUPAC name: 2,2,2-trifluoro-N-phenylethanimidoyl chloride. InChIKey: UKKALSJSKAHGTL-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3N |
|---|---|
| Molecular weight | 207.58 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-phenylethanimidoyl chloride |
| InChIKey | UKKALSJSKAHGTL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=C(C(F)(F)F)Cl |
Computed by PubChem (NCBI)