Products 1537905-51-3

CAS 1537905-51-3 is the registry number for 2,2,2-Trifluoro-N-phenylethanecarbonimidoyl chloride, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 25g, 5g.

Structural formula: {0} (CAS {1})

2,2,2-trifluoro-N-phenylethanimidoyl chloride (CAS 1537905-51-3) is a chemical compound with the molecular formula C8H5ClF3N and a molecular weight of 207.58 g/mol. IUPAC name: 2,2,2-trifluoro-N-phenylethanimidoyl chloride. InChIKey: UKKALSJSKAHGTL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClF3N
Molecular weight207.58 g/mol
IUPAC name2,2,2-trifluoro-N-phenylethanimidoyl chloride
InChIKeyUKKALSJSKAHGTL-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N=C(C(F)(F)F)Cl

Computed by PubChem (NCBI)