Products 61881-19-4

CAS 61881-19-4 appears in our catalog under these names: 2,2,2-Trifluoro-N-phenylacetimidoyl chloride, 97%, 2,2,2-Trifluoro-N-phenylacetimidoyl Chloride, 2,2,2–Trifluoro–N–phenylacetimidoyl Chloride, 2,2,2-Trifluoro-N-phenylacetimidoyl Chloride, >98.0%(GC)(T), 2,2,2-Trifluoro-N-phenylacetimidoyl Chloride 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, TCI. Available pack sizes: 100g, 1g, 5g, 25g, 500mg, 10g, 50g, 250mg.

Structural formula: {0} (CAS {1})

2,2,2-trifluoro-N-phenylethanimidoyl chloride (CAS 61881-19-4) is a chemical compound with the molecular formula C8H5ClF3N and a molecular weight of 207.58 g/mol. IUPAC name: 2,2,2-trifluoro-N-phenylethanimidoyl chloride. InChIKey: UKKALSJSKAHGTL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClF3N
Molecular weight207.58 g/mol
IUPAC name2,2,2-trifluoro-N-phenylethanimidoyl chloride
InChIKeyUKKALSJSKAHGTL-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N=C(C(F)(F)F)Cl

Computed by PubChem (NCBI)