CAS 1538005-13-8 appears in our catalog under these names: 3-(4-(1H-Pyrazol-1-yl)piperidin-1-yl)-5-fluorobenzoic acid, 98%, 3-(4-(1H-Pyrazol-1-yl)piperidin-1-yl)-5-fluorobenzoic acid, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25mg, 10mg.
3-fluoro-5-(4-pyrazol-1-ylpiperidin-1-yl)benzoic acid (CAS 1538005-13-8) is a chemical compound with the molecular formula C15H16FN3O2 and a molecular weight of 289.30 g/mol. IUPAC name: 3-fluoro-5-(4-pyrazol-1-ylpiperidin-1-yl)benzoic acid. InChIKey: OZHLUOOSMVKQJV-UHFFFAOYSA-N.
| Molecular formula | C15H16FN3O2 |
|---|---|
| Molecular weight | 289.30 g/mol |
| IUPAC name | 3-fluoro-5-(4-pyrazol-1-ylpiperidin-1-yl)benzoic acid |
| InChIKey | OZHLUOOSMVKQJV-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N2C=CC=N2)C3=CC(=CC(=C3)C(=O)O)F |
Computed by PubChem (NCBI)