CAS 160009-37-0 is the registry number for Methyl 2-Amino-4-(4-fluorophenyl)-6-isopropylpyrimidine-5-carboxylate. Offered by: TRC. Available pack sizes: 5g.
Methyl 2-amino-4-(4-fluorophenyl)-6-propan-2-ylpyrimidine-5-carboxylate (CAS 160009-37-0) is a chemical compound with the molecular formula C15H16FN3O2 and a molecular weight of 289.30 g/mol. IUPAC name: methyl 2-amino-4-(4-fluorophenyl)-6-propan-2-ylpyrimidine-5-carboxylate. InChIKey: RMYXELUYVYVDAI-UHFFFAOYSA-N.
| Molecular formula | C15H16FN3O2 |
|---|---|
| Molecular weight | 289.30 g/mol |
| IUPAC name | methyl 2-amino-4-(4-fluorophenyl)-6-propan-2-ylpyrimidine-5-carboxylate |
| InChIKey | RMYXELUYVYVDAI-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=NC(=C1C(=O)OC)C2=CC=C(C=C2)F)N |
Computed by PubChem (NCBI)