Products 1538292-18-0

CAS 1538292-18-0 is the registry number for 2-(Prop-1-yn-1-yl)thiazole-4-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-prop-1-ynyl-1,3-thiazole-4-carboxylic acid (CAS 1538292-18-0) is a chemical compound with the molecular formula C7H5NO2S and a molecular weight of 167.19 g/mol. IUPAC name: 2-prop-1-ynyl-1,3-thiazole-4-carboxylic acid. InChIKey: XVMVOUWYKLUGQE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5NO2S
Molecular weight167.19 g/mol
IUPAC name2-prop-1-ynyl-1,3-thiazole-4-carboxylic acid
InChIKeyXVMVOUWYKLUGQE-UHFFFAOYSA-N
SMILESCC#CC1=NC(=CS1)C(=O)O

Computed by PubChem (NCBI)