Products 856906-99-5

CAS 856906-99-5 is the registry number for 5-Methylfuran-2-carbonyl isothiocyanate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

5-methylfuran-2-carbonyl isothiocyanate (CAS 856906-99-5) is a chemical compound with the molecular formula C7H5NO2S and a molecular weight of 167.19 g/mol. IUPAC name: 5-methylfuran-2-carbonyl isothiocyanate. InChIKey: AFGODRXXFBWJLC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5NO2S
Molecular weight167.19 g/mol
IUPAC name5-methylfuran-2-carbonyl isothiocyanate
InChIKeyAFGODRXXFBWJLC-UHFFFAOYSA-N
SMILESCC1=CC=C(O1)C(=O)N=C=S

Computed by PubChem (NCBI)