CAS 1538422-47-7 appears in our catalog under these names: 2-((2,2,2-Trifluoroethyl)amino)-6-(trifluoromethyl)pyridine-3-carboxylic acid, 95%, 2-((2,2,2-Trifluoroethyl)amino)-6-(trifluoromethyl)pyridine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(2,2,2-trifluoroethylamino)-6-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 1538422-47-7) is a chemical compound with the molecular formula C9H6F6N2O2 and a molecular weight of 288.15 g/mol. IUPAC name: 2-(2,2,2-trifluoroethylamino)-6-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: VWPVEMDXWFZCHL-UHFFFAOYSA-N.
| Molecular formula | C9H6F6N2O2 |
|---|---|
| Molecular weight | 288.15 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethylamino)-6-(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | VWPVEMDXWFZCHL-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)O)NCC(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)