CAS 188781-15-9 appears in our catalog under these names: Ethyl 2,4-bis(trifluoromethyl)pyrimidine-5-carboxylate, 97%, 2,4-Bis-(trifluoromethyl)pyrimidine-5-carboxylic acid ethyl ester, 97% . Offered by: Combi-blocks, Thermo Scientific, Fluorochem. Available pack sizes: 5g, 1g.
Ethyl 2,4-bis(trifluoromethyl)pyrimidine-5-carboxylate (CAS 188781-15-9) is a chemical compound with the molecular formula C9H6F6N2O2 and a molecular weight of 288.15 g/mol. IUPAC name: ethyl 2,4-bis(trifluoromethyl)pyrimidine-5-carboxylate. InChIKey: SRFVAGSJHJMMME-UHFFFAOYSA-N.
| Molecular formula | C9H6F6N2O2 |
|---|---|
| Molecular weight | 288.15 g/mol |
| IUPAC name | ethyl 2,4-bis(trifluoromethyl)pyrimidine-5-carboxylate |
| InChIKey | SRFVAGSJHJMMME-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N=C1C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)