CAS 1538623-29-8 appears in our catalog under these names: Boronic acid, b-[3-[[(2-aminophenyl)amino]carbonyl]phenyl]-, 95%, (3-((2-Aminophenyl)carbamoyl)phenyl)boronic acid, 98%, 3–(2–Aminophenyl carbamoyl)phenylboronic acid, (3-((2-Aminophenyl)carbamoyl)phenyl)boronic acid, 95%, 95%, {3-[(2-AMINOPHENYL)CARBAMOYL]PHENYLBORONIC ACID, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
[3-[(2-aminophenyl)carbamoyl]phenyl]boronic acid (CAS 1538623-29-8) is a chemical compound with the molecular formula C13H13BN2O3 and a molecular weight of 256.07 g/mol. IUPAC name: [3-[(2-aminophenyl)carbamoyl]phenyl]boronic acid. InChIKey: AGKNNSIYZIVQDD-UHFFFAOYSA-N.
| Molecular formula | C13H13BN2O3 |
|---|---|
| Molecular weight | 256.07 g/mol |
| IUPAC name | [3-[(2-aminophenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | AGKNNSIYZIVQDD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2=CC=CC=C2N)(O)O |
Computed by PubChem (NCBI)