CAS 1610698-55-9 is the registry number for 4–((4–Methylpyridin–2–yl)carbamoyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
[4-[(4-methyl-2-pyridinyl)carbamoyl]phenyl]boronic acid (CAS 1610698-55-9) is a chemical compound with the molecular formula C13H13BN2O3 and a molecular weight of 256.07 g/mol. IUPAC name: [4-[(4-methyl-2-pyridinyl)carbamoyl]phenyl]boronic acid. InChIKey: VEGUCKNYFZFHQU-UHFFFAOYSA-N.
| Molecular formula | C13H13BN2O3 |
|---|---|
| Molecular weight | 256.07 g/mol |
| IUPAC name | [4-[(4-methyl-2-pyridinyl)carbamoyl]phenyl]boronic acid |
| InChIKey | VEGUCKNYFZFHQU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2=NC=CC(=C2)C)(O)O |
Computed by PubChem (NCBI)