CAS 1538665-60-9 is the registry number for (5-(4-Fluorophenyl)-1,3-oxazol-4-yl)methanol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
[5-(4-fluorophenyl)-1,3-oxazol-4-yl]methanol (CAS 1538665-60-9) is a chemical compound with the molecular formula C10H8FNO2 and a molecular weight of 193.17 g/mol. IUPAC name: [5-(4-fluorophenyl)-1,3-oxazol-4-yl]methanol. InChIKey: JVJANMNZYPSJMF-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO2 |
|---|---|
| Molecular weight | 193.17 g/mol |
| IUPAC name | [5-(4-fluorophenyl)-1,3-oxazol-4-yl]methanol |
| InChIKey | JVJANMNZYPSJMF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(N=CO2)CO)F |
Computed by PubChem (NCBI)