CAS 1538752-11-2 is the registry number for 2-(4-(Aminomethyl)-2-fluorophenyl)isothiazolidine 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-fluorophenyl]methanamine (CAS 1538752-11-2) is a chemical compound with the molecular formula C10H13FN2O2S and a molecular weight of 244.29 g/mol. IUPAC name: [4-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-fluorophenyl]methanamine. InChIKey: QCNOIXZCDSPZHB-UHFFFAOYSA-N.
| Molecular formula | C10H13FN2O2S |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | [4-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-fluorophenyl]methanamine |
| InChIKey | QCNOIXZCDSPZHB-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)C2=C(C=C(C=C2)CN)F |
Computed by PubChem (NCBI)