CAS 27106-49-6 is the registry number for 1-(4-Fluoro-benzenesulfonyl)-piperazine, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 25g, 10g.
1-(4-fluorophenyl)sulfonylpiperazine (CAS 27106-49-6) is a chemical compound with the molecular formula C10H13FN2O2S and a molecular weight of 244.29 g/mol. IUPAC name: 1-(4-fluorophenyl)sulfonylpiperazine. InChIKey: KKDHOKJGLSITHN-UHFFFAOYSA-N.
| Molecular formula | C10H13FN2O2S |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 1-(4-fluorophenyl)sulfonylpiperazine |
| InChIKey | KKDHOKJGLSITHN-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)S(=O)(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)