CAS 15396-36-8 is the registry number for Empagliflozin Impurity 180. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-3,5-diiodobenzoic acid (CAS 15396-36-8) is a chemical compound with the molecular formula C7H3ClI2O2 and a molecular weight of 408.36 g/mol. IUPAC name: 2-chloro-3,5-diiodobenzoic acid. InChIKey: ZNJCYNGNDYEMAA-UHFFFAOYSA-N.
| Molecular formula | C7H3ClI2O2 |
|---|---|
| Molecular weight | 408.36 g/mol |
| IUPAC name | 2-chloro-3,5-diiodobenzoic acid |
| InChIKey | ZNJCYNGNDYEMAA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Cl)I)I |
Computed by PubChem (NCBI)