Products 15396-36-8

CAS 15396-36-8 is the registry number for Empagliflozin Impurity 180. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-chloro-3,5-diiodobenzoic acid (CAS 15396-36-8) is a chemical compound with the molecular formula C7H3ClI2O2 and a molecular weight of 408.36 g/mol. IUPAC name: 2-chloro-3,5-diiodobenzoic acid. InChIKey: ZNJCYNGNDYEMAA-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3ClI2O2
Molecular weight408.36 g/mol
IUPAC name2-chloro-3,5-diiodobenzoic acid
InChIKeyZNJCYNGNDYEMAA-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)Cl)I)I

Computed by PubChem (NCBI)