CAS 5536-78-7 is the registry number for 4-Hydroxy-3,5-diiodobenzoyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-hydroxy-3,5-diiodobenzoyl chloride (CAS 5536-78-7) is a chemical compound with the molecular formula C7H3ClI2O2 and a molecular weight of 408.36 g/mol. IUPAC name: 4-hydroxy-3,5-diiodobenzoyl chloride. InChIKey: GPMCVEFPMQJOPS-UHFFFAOYSA-N.
| Molecular formula | C7H3ClI2O2 |
|---|---|
| Molecular weight | 408.36 g/mol |
| IUPAC name | 4-hydroxy-3,5-diiodobenzoyl chloride |
| InChIKey | GPMCVEFPMQJOPS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1I)O)I)C(=O)Cl |
Computed by PubChem (NCBI)