CAS 1539821-77-6 is the registry number for 4-Phenyl-2-(pyrimidin-2-yl)thiazole-5-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g.
4-phenyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid (CAS 1539821-77-6) is a chemical compound with the molecular formula C14H9N3O2S and a molecular weight of 283.31 g/mol. IUPAC name: 4-phenyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid. InChIKey: WHQMAOALRPAUHO-UHFFFAOYSA-N.
| Molecular formula | C14H9N3O2S |
|---|---|
| Molecular weight | 283.31 g/mol |
| IUPAC name | 4-phenyl-2-pyrimidin-2-yl-1,3-thiazole-5-carboxylic acid |
| InChIKey | WHQMAOALRPAUHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC(=N2)C3=NC=CC=N3)C(=O)O |
Computed by PubChem (NCBI)