CAS 524037-03-4 appears in our catalog under these names: 3-Nitro-5h-benzimidazo[1,2-a][3,1]benzothiazine, 95%, 3-Nitro-5H-benzo(d)benzo(4,5)imidazo(2,1-b)(1,3)thiazine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-nitro-5H-benzimidazolo[1,2-a][3,1]benzothiazine (CAS 524037-03-4) is a chemical compound with the molecular formula C14H9N3O2S and a molecular weight of 283.31 g/mol. IUPAC name: 3-nitro-5H-benzimidazolo[1,2-a][3,1]benzothiazine. InChIKey: DRBYJEQYBVUMKA-UHFFFAOYSA-N.
| Molecular formula | C14H9N3O2S |
|---|---|
| Molecular weight | 283.31 g/mol |
| IUPAC name | 3-nitro-5H-benzimidazolo[1,2-a][3,1]benzothiazine |
| InChIKey | DRBYJEQYBVUMKA-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)[N+](=O)[O-])N3C4=CC=CC=C4N=C3S1 |
Computed by PubChem (NCBI)