CAS 1540018-38-9 is the registry number for 1-(3-Bromophenyl)-2,2-difluoroethan-1-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(3-bromophenyl)-2,2-difluoroethanol (CAS 1540018-38-9) is a chemical compound with the molecular formula C8H7BrF2O and a molecular weight of 237.04 g/mol. IUPAC name: 1-(3-bromophenyl)-2,2-difluoroethanol. InChIKey: OEAKNZDZYSNZMG-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF2O |
|---|---|
| Molecular weight | 237.04 g/mol |
| IUPAC name | 1-(3-bromophenyl)-2,2-difluoroethanol |
| InChIKey | OEAKNZDZYSNZMG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(C(F)F)O |
Computed by PubChem (NCBI)