Products 1540612-53-0
CAS 1540612-53-0 is the registry number for (4-Bromo-3-methylphenyl)methanesulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4-bromo-3-methylphenyl)methanesulfonamide (CAS 1540612-53-0) is a chemical compound with the molecular formula C8H10BrNO2S and a molecular weight of 264.14 g/mol. IUPAC name: (4-bromo-3-methylphenyl)methanesulfonamide. InChIKey: LAUFISBFCGSNLP-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO2S |
|---|---|
| Molecular weight | 264.14 g/mol |
| IUPAC name | (4-bromo-3-methylphenyl)methanesulfonamide |
| InChIKey | LAUFISBFCGSNLP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)CS(=O)(=O)N)Br |
Computed by PubChem (NCBI)