CAS 154128-88-8 appears in our catalog under these names: (Perfluorophenyl)methanamine hydrochloride, 98%, (Pentafluorophenyl)methanamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(2,3,4,5,6-pentafluorophenyl)methanamine;hydrochloride (CAS 154128-88-8) is a chemical compound with the molecular formula C7H5ClF5N and a molecular weight of 233.56 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl)methanamine;hydrochloride. InChIKey: PDFKMRFDNPPFRZ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF5N |
|---|---|
| Molecular weight | 233.56 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl)methanamine;hydrochloride |
| InChIKey | PDFKMRFDNPPFRZ-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1F)F)F)F)F)N.Cl |
Computed by PubChem (NCBI)