CAS 2287331-32-0 is the registry number for 2,5-Difluoro-4-(trifluoromethyl)aniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2,5-difluoro-4-(trifluoromethyl)aniline;hydrochloride (CAS 2287331-32-0) is a chemical compound with the molecular formula C7H5ClF5N and a molecular weight of 233.56 g/mol. IUPAC name: 2,5-difluoro-4-(trifluoromethyl)aniline;hydrochloride. InChIKey: ANFOSFDZTUTIKS-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF5N |
|---|---|
| Molecular weight | 233.56 g/mol |
| IUPAC name | 2,5-difluoro-4-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | ANFOSFDZTUTIKS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)N)F)C(F)(F)F.Cl |
Computed by PubChem (NCBI)