Products 1541352-26-4

CAS 1541352-26-4 appears in our catalog under these names: 3,3-Dicyclobutylpropanoic acid, 95%, 3,3-Dicyclobutylpropanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

3,3-di(cyclobutyl)propanoic acid (CAS 1541352-26-4) is a chemical compound with the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. IUPAC name: 3,3-di(cyclobutyl)propanoic acid. InChIKey: RGDXNRXPYAMLFH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18O2
Molecular weight182.26 g/mol
IUPAC name3,3-di(cyclobutyl)propanoic acid
InChIKeyRGDXNRXPYAMLFH-UHFFFAOYSA-N
SMILESC1CC(C1)C(CC(=O)O)C2CCC2

Computed by PubChem (NCBI)