CAS 1542093-63-9 is the registry number for 2-(4,5-Dimethyl-1H-imidazol-1-yl)-1H-1,3-benzodiazol-5-amine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(4,5-dimethylimidazol-1-yl)-3H-benzimidazol-5-amine (CAS 1542093-63-9) is a chemical compound with the molecular formula C12H13N5 and a molecular weight of 227.27 g/mol. IUPAC name: 2-(4,5-dimethylimidazol-1-yl)-3H-benzimidazol-5-amine. InChIKey: ZZEBBSNPEONQAZ-UHFFFAOYSA-N.
| Molecular formula | C12H13N5 |
|---|---|
| Molecular weight | 227.27 g/mol |
| IUPAC name | 2-(4,5-dimethylimidazol-1-yl)-3H-benzimidazol-5-amine |
| InChIKey | ZZEBBSNPEONQAZ-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C=N1)C2=NC3=C(N2)C=C(C=C3)N)C |
Computed by PubChem (NCBI)