CAS 1794759-37-7 is the registry number for 1,6,7-Trimethyl-1H-imidazo(4,5-g)quinoxalin-2-amine-d3. Offered by: TRC. Available pack sizes: 10mg, 1mg.
6,7-dimethyl-3-(trideuteriomethyl)imidazo[4,5-g]quinoxalin-2-amine (CAS 1794759-37-7) is a chemical compound with the molecular formula C12H13N5 and a molecular weight of 230.28 g/mol. IUPAC name: 6,7-dimethyl-3-(trideuteriomethyl)imidazo[4,5-g]quinoxalin-2-amine. InChIKey: GLLXPOZOEKDRLU-HPRDVNIFSA-N.
| Molecular formula | C12H13N5 |
|---|---|
| Molecular weight | 230.28 g/mol |
| IUPAC name | 6,7-dimethyl-3-(trideuteriomethyl)imidazo[4,5-g]quinoxalin-2-amine |
| InChIKey | GLLXPOZOEKDRLU-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])N1C2=C(C=C3C(=C2)N=C(C(=N3)C)C)N=C1N |
Computed by PubChem (NCBI)