CAS 154226-60-5 appears in our catalog under these names: Clasto–Lactacystin β–lactone, Clasto-lactacystin(Omuralide), clasto-Lactacystin b-lactone, CLASTO-LACTACYSTIN B-LACTONE 1PC X 100UG, CLASTO-LACTACYSTIN B-LACTONE 1PC X 10MG. Offered by: GLPBio, TRC, Chemat, Sigma-Aldrich, MedChemExpress. Available pack sizes: 500ug, 0,1mg, 0,5mg, 50µg, 50ug, 100ug, 1mg, 200ug.
(1R,4R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-4-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (CAS 154226-60-5) is a chemical compound with the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. IUPAC name: (1R,4R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-4-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione. InChIKey: FWPWHHUJACGNMZ-NBBQQVJHSA-N.
| Molecular formula | C10H15NO4 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | (1R,4R,5S)-1-[(1S)-1-hydroxy-2-methylpropyl]-4-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| InChIKey | FWPWHHUJACGNMZ-NBBQQVJHSA-N |
| SMILES | C[C@@H]1[C@H]2[C@](C(=O)O2)(NC1=O)[C@H](C(C)C)O |
Computed by PubChem (NCBI)