Products 154233-41-7
CAS 154233-41-7 is the registry number for (2-Chlorophenyl)(4-fluorophenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2-chlorophenyl)-(4-fluorophenyl)methanamine;hydrochloride (CAS 154233-41-7) is a chemical compound with the molecular formula C13H12Cl2FN and a molecular weight of 272.14 g/mol. IUPAC name: (2-chlorophenyl)-(4-fluorophenyl)methanamine;hydrochloride. InChIKey: UDJHOYCZXWLSGR-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl2FN |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | (2-chlorophenyl)-(4-fluorophenyl)methanamine;hydrochloride |
| InChIKey | UDJHOYCZXWLSGR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C2=CC=C(C=C2)F)N)Cl.Cl |
Computed by PubChem (NCBI)