CAS 2206265-88-3 is the registry number for C-(4-Chloro-3-fluoro-phenyl)-c-phenyl-methylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(4-chloro-3-fluorophenyl)-phenylmethanamine;hydrochloride (CAS 2206265-88-3) is a chemical compound with the molecular formula C13H12Cl2FN and a molecular weight of 272.14 g/mol. IUPAC name: (4-chloro-3-fluorophenyl)-phenylmethanamine;hydrochloride. InChIKey: SIODJTUBKYCEBC-UHFFFAOYSA-N.
| Molecular formula | C13H12Cl2FN |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | (4-chloro-3-fluorophenyl)-phenylmethanamine;hydrochloride |
| InChIKey | SIODJTUBKYCEBC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC(=C(C=C2)Cl)F)N.Cl |
Computed by PubChem (NCBI)