CAS 154242-44-1 is the registry number for rel-tert-Butyl ((3S,4R)-1-benzyl-4-(3,4-dichlorophenyl)pyrrolidin-3-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(3S,4R)-1-benzyl-4-(3,4-dichlorophenyl)pyrrolidin-3-yl]carbamate (CAS 154242-44-1) is a chemical compound with the molecular formula C22H26Cl2N2O2 and a molecular weight of 421.4 g/mol. IUPAC name: tert-butyl N-[(3S,4R)-1-benzyl-4-(3,4-dichlorophenyl)pyrrolidin-3-yl]carbamate. InChIKey: DOOSTEAVZWRRGL-FXAWDEMLSA-N.
| Molecular formula | C22H26Cl2N2O2 |
|---|---|
| Molecular weight | 421.4 g/mol |
| IUPAC name | tert-butyl N-[(3S,4R)-1-benzyl-4-(3,4-dichlorophenyl)pyrrolidin-3-yl]carbamate |
| InChIKey | DOOSTEAVZWRRGL-FXAWDEMLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CN(C[C@H]1C2=CC(=C(C=C2)Cl)Cl)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)