Products 918161-24-7
CAS 918161-24-7 is the registry number for tert-Butyl 4-(bis(4-chlorophenyl)methyl)piperazine-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
Tert-butyl 4-[bis(4-chlorophenyl)methyl]piperazine-1-carboxylate (CAS 918161-24-7) is a chemical compound with the molecular formula C22H26Cl2N2O2 and a molecular weight of 421.4 g/mol. IUPAC name: tert-butyl 4-[bis(4-chlorophenyl)methyl]piperazine-1-carboxylate. InChIKey: UCYQJYXGWYVOII-UHFFFAOYSA-N.
| Molecular formula | C22H26Cl2N2O2 |
|---|---|
| Molecular weight | 421.4 g/mol |
| IUPAC name | tert-butyl 4-[bis(4-chlorophenyl)methyl]piperazine-1-carboxylate |
| InChIKey | UCYQJYXGWYVOII-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(C2=CC=C(C=C2)Cl)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)