CAS 154257-86-0 is the registry number for 1-(3-Bromo-2,4-dimethylphenyl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-bromo-2,4-dimethylphenyl)ethanone (CAS 154257-86-0) is a chemical compound with the molecular formula C10H11BrO and a molecular weight of 227.10 g/mol. IUPAC name: 1-(3-bromo-2,4-dimethylphenyl)ethanone. InChIKey: STTQGDWADMFDQJ-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO |
|---|---|
| Molecular weight | 227.10 g/mol |
| IUPAC name | 1-(3-bromo-2,4-dimethylphenyl)ethanone |
| InChIKey | STTQGDWADMFDQJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)C)C)Br |
Computed by PubChem (NCBI)