CAS 154258-48-7 appears in our catalog under these names: 1-(3-Chloro-4-fluorophenyl)-3-(dimethylamino)prop-2-en-1-one, 95%, 1-(3-chloro-4-fluorophenyl)-3-(dimethylamino)prop-2-en-1-one. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
(E)-1-(3-chloro-4-fluorophenyl)-3-(dimethylamino)prop-2-en-1-one (CAS 154258-48-7) is a chemical compound with the molecular formula C11H11ClFNO and a molecular weight of 227.66 g/mol. IUPAC name: (E)-1-(3-chloro-4-fluorophenyl)-3-(dimethylamino)prop-2-en-1-one. InChIKey: ZOJGJDORYXDPEO-AATRIKPKSA-N.
| Molecular formula | C11H11ClFNO |
|---|---|
| Molecular weight | 227.66 g/mol |
| IUPAC name | (E)-1-(3-chloro-4-fluorophenyl)-3-(dimethylamino)prop-2-en-1-one |
| InChIKey | ZOJGJDORYXDPEO-AATRIKPKSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC(=C(C=C1)F)Cl |
Computed by PubChem (NCBI)