Products 2413481-81-7
CAS 2413481-81-7 is the registry number for 5-Amino-6-fluoro-2-methylnaphthalen-1-ol hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-amino-6-fluoro-2-methylnaphthalen-1-ol;hydrochloride (CAS 2413481-81-7) is a chemical compound with the molecular formula C11H11ClFNO and a molecular weight of 227.66 g/mol. IUPAC name: 5-amino-6-fluoro-2-methylnaphthalen-1-ol;hydrochloride. InChIKey: KKGOIGNCRDVEQT-UHFFFAOYSA-N.
| Molecular formula | C11H11ClFNO |
|---|---|
| Molecular weight | 227.66 g/mol |
| IUPAC name | 5-amino-6-fluoro-2-methylnaphthalen-1-ol;hydrochloride |
| InChIKey | KKGOIGNCRDVEQT-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=C(C=C2)F)N)O.Cl |
Computed by PubChem (NCBI)