Products 1543013-96-2
CAS 1543013-96-2 is the registry number for CRBN ligand-190. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(3-fluorophenyl)-1,3-diazinane-2,4-dione (CAS 1543013-96-2) is a chemical compound with the molecular formula C10H9FN2O2 and a molecular weight of 208.19 g/mol. IUPAC name: 1-(3-fluorophenyl)-1,3-diazinane-2,4-dione. InChIKey: FAJCPULNZCTQQU-UHFFFAOYSA-N.
| Molecular formula | C10H9FN2O2 |
|---|---|
| Molecular weight | 208.19 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-1,3-diazinane-2,4-dione |
| InChIKey | FAJCPULNZCTQQU-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)