Products 154306-81-7
CAS 154306-81-7 appears in our catalog under these names: Docetaxel Impurity 56, Docetaxel Impurity 43. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(3R,4S)-3-hydroxy-4-phenyl-1-[(1S)-1-phenylethyl]azetidin-2-one (CAS 154306-81-7) is a chemical compound with the molecular formula C17H17NO2 and a molecular weight of 267.32 g/mol. IUPAC name: (3R,4S)-3-hydroxy-4-phenyl-1-[(1S)-1-phenylethyl]azetidin-2-one. InChIKey: ZQYVUTPAPKYYNK-VBNZEHGJSA-N.
| Molecular formula | C17H17NO2 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | (3R,4S)-3-hydroxy-4-phenyl-1-[(1S)-1-phenylethyl]azetidin-2-one |
| InChIKey | ZQYVUTPAPKYYNK-VBNZEHGJSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N2[C@H]([C@H](C2=O)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)