Products 1543135-42-7

CAS 1543135-42-7 is the registry number for 1-(3-Fluorobenzyl)-3-methyl-1h-pyrazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-[(3-fluorophenyl)methyl]-5-methylpyrazole-3-carboxylic acid (CAS 1543135-42-7) is a chemical compound with the molecular formula C12H11FN2O2 and a molecular weight of 234.23 g/mol. IUPAC name: 2-[(3-fluorophenyl)methyl]-5-methylpyrazole-3-carboxylic acid. InChIKey: KSQQJSFPTVWKJN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H11FN2O2
Molecular weight234.23 g/mol
IUPAC name2-[(3-fluorophenyl)methyl]-5-methylpyrazole-3-carboxylic acid
InChIKeyKSQQJSFPTVWKJN-UHFFFAOYSA-N
SMILESCC1=NN(C(=C1)C(=O)O)CC2=CC(=CC=C2)F

Computed by PubChem (NCBI)