CAS 60725-58-8 appears in our catalog under these names: 2-(4-Fluorophenyl)-hexahydro-1h-pyrrolo[1,2-a]imidazolidine-1,3-dione, 95%, 2-(4-Fluorophenyl)-hexahydro-1H-pyrrolo(1,2-c)imidazolidine-1,3-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(4-fluorophenyl)-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (CAS 60725-58-8) is a chemical compound with the molecular formula C12H11FN2O2 and a molecular weight of 234.23 g/mol. IUPAC name: 2-(4-fluorophenyl)-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione. InChIKey: JGUIUTGWRXDUGS-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2O2 |
|---|---|
| Molecular weight | 234.23 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| InChIKey | JGUIUTGWRXDUGS-UHFFFAOYSA-N |
| SMILES | C1CC2C(=O)N(C(=O)N2C1)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)