Products 154404-89-4

CAS 154404-89-4 is the registry number for 2-(3-Pyridinyl)-5,6-dihydro-1,3-benzothiazol-7(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-pyridin-3-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one (CAS 154404-89-4) is a chemical compound with the molecular formula C12H10N2OS and a molecular weight of 230.29 g/mol. IUPAC name: 2-pyridin-3-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one. InChIKey: COKVUYJORMEUSU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10N2OS
Molecular weight230.29 g/mol
IUPAC name2-pyridin-3-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one
InChIKeyCOKVUYJORMEUSU-UHFFFAOYSA-N
SMILESC1CC2=C(C(=O)C1)SC(=N2)C3=CN=CC=C3

Computed by PubChem (NCBI)