CAS 915920-15-9 is the registry number for 2-(Benzylthio)pyrimidine-5-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-benzylsulfanylpyrimidine-5-carbaldehyde (CAS 915920-15-9) is a chemical compound with the molecular formula C12H10N2OS and a molecular weight of 230.29 g/mol. IUPAC name: 2-benzylsulfanylpyrimidine-5-carbaldehyde. InChIKey: VLTDTICMHNEHCX-UHFFFAOYSA-N.
| Molecular formula | C12H10N2OS |
|---|---|
| Molecular weight | 230.29 g/mol |
| IUPAC name | 2-benzylsulfanylpyrimidine-5-carbaldehyde |
| InChIKey | VLTDTICMHNEHCX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NC=C(C=N2)C=O |
Computed by PubChem (NCBI)