Products 1544096-44-7

CAS 1544096-44-7 is the registry number for 4-(But-3-en-2-yl)thiomorpholine-3-carboxylic acid, 98% +(stabilized with TBC). Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-but-3-en-2-ylthiomorpholine-3-carboxylic acid (CAS 1544096-44-7) is a chemical compound with the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. IUPAC name: 4-but-3-en-2-ylthiomorpholine-3-carboxylic acid. InChIKey: ILKLCHZOKCCZGF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15NO2S
Molecular weight201.29 g/mol
IUPAC name4-but-3-en-2-ylthiomorpholine-3-carboxylic acid
InChIKeyILKLCHZOKCCZGF-UHFFFAOYSA-N
SMILESCC(C=C)N1CCSCC1C(=O)O

Computed by PubChem (NCBI)