Products 1604023-47-3

CAS 1604023-47-3 is the registry number for 3-(2,2-Dimethylthiomorpholin-4-yl)prop-2-enoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(E)-3-(2,2-dimethylthiomorpholin-4-yl)prop-2-enoic acid (CAS 1604023-47-3) is a chemical compound with the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. IUPAC name: (E)-3-(2,2-dimethylthiomorpholin-4-yl)prop-2-enoic acid. InChIKey: NTDQBHAUOQXICY-ONEGZZNKSA-N.

Identity
Molecular formulaC9H15NO2S
Molecular weight201.29 g/mol
IUPAC name(E)-3-(2,2-dimethylthiomorpholin-4-yl)prop-2-enoic acid
InChIKeyNTDQBHAUOQXICY-ONEGZZNKSA-N
SMILESCC1(CN(CCS1)/C=C/C(=O)O)C

Computed by PubChem (NCBI)