CAS 1604023-47-3 is the registry number for 3-(2,2-Dimethylthiomorpholin-4-yl)prop-2-enoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(2,2-dimethylthiomorpholin-4-yl)prop-2-enoic acid (CAS 1604023-47-3) is a chemical compound with the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. IUPAC name: (E)-3-(2,2-dimethylthiomorpholin-4-yl)prop-2-enoic acid. InChIKey: NTDQBHAUOQXICY-ONEGZZNKSA-N.
| Molecular formula | C9H15NO2S |
|---|---|
| Molecular weight | 201.29 g/mol |
| IUPAC name | (E)-3-(2,2-dimethylthiomorpholin-4-yl)prop-2-enoic acid |
| InChIKey | NTDQBHAUOQXICY-ONEGZZNKSA-N |
| SMILES | CC1(CN(CCS1)/C=C/C(=O)O)C |
Computed by PubChem (NCBI)