CAS 443346-71-2 is the registry number for 4-(Cyclohexylmethoxy)benzene-1-sulfonyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(cyclohexylmethoxy)benzenesulfonyl chloride (CAS 443346-71-2) is a chemical compound with the molecular formula C13H17ClO3S and a molecular weight of 288.79 g/mol. IUPAC name: 4-(cyclohexylmethoxy)benzenesulfonyl chloride. InChIKey: BGNKJQNZDJMFFJ-UHFFFAOYSA-N.
| Molecular formula | C13H17ClO3S |
|---|---|
| Molecular weight | 288.79 g/mol |
| IUPAC name | 4-(cyclohexylmethoxy)benzenesulfonyl chloride |
| InChIKey | BGNKJQNZDJMFFJ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)COC2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)