CAS 1545161-09-8 appears in our catalog under these names: 1-(3-Aminophenyl)-1,3-dimethylurea, 95%, 1-(3-Aminophenyl)-1,3-dimethylurea. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(3-aminophenyl)-1,3-dimethylurea (CAS 1545161-09-8) is a chemical compound with the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. IUPAC name: 1-(3-aminophenyl)-1,3-dimethylurea. InChIKey: ITZKYZXZGIOJMY-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 1-(3-aminophenyl)-1,3-dimethylurea |
| InChIKey | ITZKYZXZGIOJMY-UHFFFAOYSA-N |
| SMILES | CNC(=O)N(C)C1=CC=CC(=C1)N |
Computed by PubChem (NCBI)