Products 1545575-90-3
CAS 1545575-90-3 is the registry number for 4-(4-Bromo-2-fluorophenyl)thiazol-2-amine, 95%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-(4-bromo-2-fluorophenyl)-1,3-thiazol-2-amine (CAS 1545575-90-3) is a chemical compound with the molecular formula C9H6BrFN2S and a molecular weight of 273.13 g/mol. IUPAC name: 4-(4-bromo-2-fluorophenyl)-1,3-thiazol-2-amine. InChIKey: VMYOYYYRMGAFGA-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFN2S |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | 4-(4-bromo-2-fluorophenyl)-1,3-thiazol-2-amine |
| InChIKey | VMYOYYYRMGAFGA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C2=CSC(=N2)N |
Computed by PubChem (NCBI)