CAS 1566231-20-6 is the registry number for 4-(4-Bromo-3-fluorophenyl)thiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-bromo-3-fluorophenyl)-1,3-thiazol-2-amine (CAS 1566231-20-6) is a chemical compound with the molecular formula C9H6BrFN2S and a molecular weight of 273.13 g/mol. IUPAC name: 4-(4-bromo-3-fluorophenyl)-1,3-thiazol-2-amine. InChIKey: VSZRHFCFRAHXJN-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFN2S |
|---|---|
| Molecular weight | 273.13 g/mol |
| IUPAC name | 4-(4-bromo-3-fluorophenyl)-1,3-thiazol-2-amine |
| InChIKey | VSZRHFCFRAHXJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CSC(=N2)N)F)Br |
Computed by PubChem (NCBI)