CAS 154593-58-5 appears in our catalog under these names: (S)–2–Amino–3–(5–bromothiophen–2–yl)propanoic acid, (S)-2-Amino-3-(5-bromothiophen-2-yl)propanoic acid, 95%, 95%, (S)-2-Amino-3-(5-bromothiophen-2-yl)propanoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
(2S)-2-amino-3-(5-bromothiophen-2-yl)propanoic acid (CAS 154593-58-5) is a chemical compound with the molecular formula C7H8BrNO2S and a molecular weight of 250.12 g/mol. IUPAC name: (2S)-2-amino-3-(5-bromothiophen-2-yl)propanoic acid. InChIKey: LKORPMMOJAJYLC-YFKPBYRVSA-N.
| Molecular formula | C7H8BrNO2S |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | (2S)-2-amino-3-(5-bromothiophen-2-yl)propanoic acid |
| InChIKey | LKORPMMOJAJYLC-YFKPBYRVSA-N |
| SMILES | C1=C(SC(=C1)Br)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)