CAS 264903-54-0 appears in our catalog under these names: D-2-(5-Bromothienyl)alanine, 97%, (R)-2-Amino-3-(5-bromothiophen-2-yl)propanoic acid, 97%, (R)–2–Amino–3–(5–bromothiophen–2–yl)propanoic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g.
(2R)-2-amino-3-(5-bromothiophen-2-yl)propanoic acid (CAS 264903-54-0) is a chemical compound with the molecular formula C7H8BrNO2S and a molecular weight of 250.12 g/mol. IUPAC name: (2R)-2-amino-3-(5-bromothiophen-2-yl)propanoic acid. InChIKey: LKORPMMOJAJYLC-RXMQYKEDSA-N.
| Molecular formula | C7H8BrNO2S |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | (2R)-2-amino-3-(5-bromothiophen-2-yl)propanoic acid |
| InChIKey | LKORPMMOJAJYLC-RXMQYKEDSA-N |
| SMILES | C1=C(SC(=C1)Br)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)