Products 1546131-19-4

CAS 1546131-19-4 is the registry number for 2-(3-Fluorobenzyl)-2,3-dimethylbutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(3-fluorophenyl)methyl]-2,3-dimethylbutanoic acid (CAS 1546131-19-4) is a chemical compound with the molecular formula C13H17FO2 and a molecular weight of 224.27 g/mol. IUPAC name: 2-[(3-fluorophenyl)methyl]-2,3-dimethylbutanoic acid. InChIKey: FFIOTDSZQPTQFW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17FO2
Molecular weight224.27 g/mol
IUPAC name2-[(3-fluorophenyl)methyl]-2,3-dimethylbutanoic acid
InChIKeyFFIOTDSZQPTQFW-UHFFFAOYSA-N
SMILESCC(C)C(C)(CC1=CC(=CC=C1)F)C(=O)O

Computed by PubChem (NCBI)