Products 2107198-78-5

CAS 2107198-78-5 is the registry number for Ethyl 3-(4-fluorophenyl)-2-methylbutanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 3-(4-fluorophenyl)-2-methylbutanoate (CAS 2107198-78-5) is a chemical compound with the molecular formula C13H17FO2 and a molecular weight of 224.27 g/mol. IUPAC name: ethyl 3-(4-fluorophenyl)-2-methylbutanoate. InChIKey: ADESQKOOUKEVNB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17FO2
Molecular weight224.27 g/mol
IUPAC nameethyl 3-(4-fluorophenyl)-2-methylbutanoate
InChIKeyADESQKOOUKEVNB-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)C(C)C1=CC=C(C=C1)F

Computed by PubChem (NCBI)