Products 15463-92-0
CAS 15463-92-0 appears in our catalog under these names: Dimethyl 2-phenylbutanedioate, 96%, Dimethyl 2-phenylbutanedioate 96%, Dimethyl 2-phenylbutanedioate, 96%, 96%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
Dimethyl 2-phenylbutanedioate (CAS 15463-92-0) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: dimethyl 2-phenylbutanedioate. InChIKey: CGVIBFZHFCVINR-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | dimethyl 2-phenylbutanedioate |
| InChIKey | CGVIBFZHFCVINR-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C1=CC=CC=C1)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
dimethyl 2-phenylbutanedioate, 2-(Phenyl)succinic acid dimethyl ester, Butanedioic acid, phenyl-, dimethyl ester, Dimethyl 2-phenylsuccinate, Dimethyl phenylsuccinate, 2-phenyl-butanedioic acid dimethyl ester, PHENYLSUCCINIC ACID DIMETHYL ESTER, 2-Phenylsuccinic acid dimethyl, 2-Phenylsuccinic acid dimethyl ester, 2-Phenylbutanedioic acid dimethyl ester