CAS 154640-05-8 is the registry number for 8-Amino-3-methyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.
8-amino-3-methyl-7H-purine-2,6-dione (CAS 154640-05-8) is a chemical compound with the molecular formula C6H7N5O2 and a molecular weight of 181.15 g/mol. IUPAC name: 8-amino-3-methyl-7H-purine-2,6-dione. InChIKey: NJOYYTJYAMKQAG-UHFFFAOYSA-N.
| Molecular formula | C6H7N5O2 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 8-amino-3-methyl-7H-purine-2,6-dione |
| InChIKey | NJOYYTJYAMKQAG-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)NC1=O)NC(=N2)N |
Computed by PubChem (NCBI)